C19H19N3O5 — CID 97012490
(4-nitrophenyl)methyl (2R)-1-(pyridine-3-carbonyl)piperidine-2-carboxylate (PubChem CID 97012490) has the molecular formula C19H19N3O5 and a molecular weight of 369.38 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2R)-1-(pyridine-3-carbonyl)piperidine-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2R)-1-(pyridine-3-carbonyl)piperidine-2-carboxylate |
|---|---|
| PubChem CID | 97012490 |
| Molecular Formula | C19H19N3O5 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | (4-nitrophenyl)methyl (2R)-1-(pyridine-3-carbonyl)piperidine-2-carboxylate |
| SMILES | O=C(OCc1ccc([N+](=O)[O-])cc1)[C@H]1CCCCN1C(=O)c1cccnc1 |
| InChI | InChI=1S/C19H19N3O5/c23-18(15-4-3-10-20-12-15)21-11-2-1-5-17(21)19(24)27-13-14-6-8-16(9-7-14)22(25)26/h3-4,6-10,12,17H,1-2,5,11,13H2/t17-/m1/s1 |
| InChIKey | ZPZYFPTVLNXJMC-QGZVFWFLSA-N |
| XLogP | 2.73 |
| TPSA | 102.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|