C21H16N4O6 — CID 166687231
[1-(pyridine-3-carbonyl)pyrrolidine-2-carbonyl] 5-nitroquinoline-8-carboxylate (PubChem CID 166687231) has the molecular formula C21H16N4O6 and a molecular weight of 420.38 g/mol. Its IUPAC name is [1-(pyridine-3-carbonyl)pyrrolidine-2-carbonyl] 5-nitroquinoline-8-carboxylate.
| Compound Name | [1-(pyridine-3-carbonyl)pyrrolidine-2-carbonyl] 5-nitroquinoline-8-carboxylate |
|---|---|
| PubChem CID | 166687231 |
| Molecular Formula | C21H16N4O6 |
| Molecular Weight | 420.38 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | [1-(pyridine-3-carbonyl)pyrrolidine-2-carbonyl] 5-nitroquinoline-8-carboxylate |
| SMILES | O=C(OC(=O)C1CCCN1C(=O)c1cccnc1)c1ccc([N+](=O)[O-])c2cccnc12 |
| InChI | InChI=1S/C21H16N4O6/c26-19(13-4-1-9-22-12-13)24-11-3-6-17(24)21(28)31-20(27)15-7-8-16(25(29)30)14-5-2-10-23-18(14)15/h1-2,4-5,7-10,12,17H,3,6,11H2 |
| InChIKey | NWNPDUXDYOKHDZ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 132.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.38 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|