About 1-O-tert-butyl 2-O-[(5-nitroquinolin-8-yl)oxymethyl] (2S)-pyrrolidine-1,2-dicarboxylate
1-O-tert-butyl 2-O-[(5-nitroquinolin-8-yl)oxymethyl] (2S)-pyrrolidine-1,2-dicarboxylate (PubChem CID 156758703) has the molecular formula C20H23N3O7
and a molecular weight of 417.42 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-[(5-nitroquinolin-8-yl)oxymethyl] (2S)-pyrrolidine-1,2-dicarboxylate.
Molecular Properties
| Compound Name | 1-O-tert-butyl 2-O-[(5-nitroquinolin-8-yl)oxymethyl] (2S)-pyrrolidine-1,2-dicarboxylate |
| PubChem CID | 156758703 |
| Molecular Formula | C20H23N3O7 |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 1-O-tert-butyl 2-O-[(5-nitroquinolin-8-yl)oxymethyl] (2S)-pyrrolidine-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1C(=O)OCOc1ccc([N+](=O)[O-])c2cccnc12 |
| InChI | InChI=1S/C20H23N3O7/c1-20(2,3)30-19(25)22-11-5-7-15(22)18(24)29-12-28-16-9-8-14(23(26)27)13-6-4-10-21-17(13)16/h4,6,8-10,15H,5,7,11-12H2,1-3H3/t15-/m0/s1 |
| InChIKey | WCFQSSUPVAYHGT-HNNXBMFYSA-N |
| XLogP | 3.42 |
| TPSA | 121.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-O-tert-butyl 2-O-[(5-nitroquinolin-8-yl)oxymethyl] (2S)-pyrrolidine-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-tert-butyl 2-O-[(5-nitroquinolin-8-yl)oxymethyl] (2S)-pyrrolidine-1,2-dicarboxylate?
The IUPAC name of 1-O-tert-butyl 2-O-[(5-nitroquinolin-8-yl)oxymethyl] (2S)-pyrrolidine-1,2-dicarboxylate (CID 156758703) is 1-O-tert-butyl 2-O-[(5-nitroquinolin-8-yl)oxymethyl] (2S)-pyrrolidine-1,2-dicarboxylate.
What is the SMILES notation for 1-O-tert-butyl 2-O-[(5-nitroquinolin-8-yl)oxymethyl] (2S)-pyrrolidine-1,2-dicarboxylate?
The canonical SMILES for 1-O-tert-butyl 2-O-[(5-nitroquinolin-8-yl)oxymethyl] (2S)-pyrrolidine-1,2-dicarboxylate is CC(C)(C)OC(=O)N1CCC[C@H]1C(=O)OCOc1ccc([N+](=O)[O-])c2cccnc12.
What is the InChIKey of 1-O-tert-butyl 2-O-[(5-nitroquinolin-8-yl)oxymethyl] (2S)-pyrrolidine-1,2-dicarboxylate?
The InChIKey is WCFQSSUPVAYHGT-HNNXBMFYSA-N. The full InChI is InChI=1S/C20H23N3O7/c1-20(2,3)30-19(25)22-11-5-7-15(22)18(24)29-12-28-16-9-8-14(23(26)27)13-6-4-10-21-17(13)16/h4,6,8-10,15H,5,7,11-12H2,1-3H3/t15-/m0/s1.
What are the key properties of 1-O-tert-butyl 2-O-[(5-nitroquinolin-8-yl)oxymethyl] (2S)-pyrrolidine-1,2-dicarboxylate?
1-O-tert-butyl 2-O-[(5-nitroquinolin-8-yl)oxymethyl] (2S)-pyrrolidine-1,2-dicarboxylate has a molecular weight of 417.42 g/mol, XLogP of 3.42, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-tert-butyl 2-O-[(5-nitroquinolin-8-yl)oxymethyl] (2S)-pyrrolidine-1,2-dicarboxylate is sourced from PubChem (CID 156758703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).