C21H18N4O6 — CID 163951231
(5-nitroquinolin-8-yl)oxymethyl 1-(pyridine-4-carbonyl)pyrrolidine-2-carboxylate (PubChem CID 163951231) has the molecular formula C21H18N4O6 and a molecular weight of 422.40 g/mol. Its IUPAC name is (5-nitroquinolin-8-yl)oxymethyl 1-(pyridine-4-carbonyl)pyrrolidine-2-carboxylate.
| Compound Name | (5-nitroquinolin-8-yl)oxymethyl 1-(pyridine-4-carbonyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 163951231 |
| Molecular Formula | C21H18N4O6 |
| Molecular Weight | 422.40 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | (5-nitroquinolin-8-yl)oxymethyl 1-(pyridine-4-carbonyl)pyrrolidine-2-carboxylate |
| SMILES | O=C(OCOc1ccc([N+](=O)[O-])c2cccnc12)C1CCCN1C(=O)c1ccncc1 |
| InChI | InChI=1S/C21H18N4O6/c26-20(14-7-10-22-11-8-14)24-12-2-4-17(24)21(27)31-13-30-18-6-5-16(25(28)29)15-3-1-9-23-19(15)18/h1,3,5-11,17H,2,4,12-13H2 |
| InChIKey | RZMODNPMGWPYKJ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 124.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.40 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|