About 1-O-methyl 6-O-[(5-nitroquinolin-8-yl)oxymethyl] hexanedioate
1-O-methyl 6-O-[(5-nitroquinolin-8-yl)oxymethyl] hexanedioate (PubChem CID 149115733) has the molecular formula C17H18N2O7
and a molecular weight of 362.34 g/mol. Its IUPAC name is 1-O-methyl 6-O-[(5-nitroquinolin-8-yl)oxymethyl] hexanedioate.
Molecular Properties
| Compound Name | 1-O-methyl 6-O-[(5-nitroquinolin-8-yl)oxymethyl] hexanedioate |
| PubChem CID | 149115733 |
| Molecular Formula | C17H18N2O7 |
| Molecular Weight | 362.34 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 1-O-methyl 6-O-[(5-nitroquinolin-8-yl)oxymethyl] hexanedioate |
| SMILES | COC(=O)CCCCC(=O)OCOc1ccc([N+](=O)[O-])c2cccnc12 |
| InChI | InChI=1S/C17H18N2O7/c1-24-15(20)6-2-3-7-16(21)26-11-25-14-9-8-13(19(22)23)12-5-4-10-18-17(12)14/h4-5,8-10H,2-3,6-7,11H2,1H3 |
| InChIKey | QYIISFBNOMTLEI-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 117.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.34 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-O-methyl 6-O-[(5-nitroquinolin-8-yl)oxymethyl] hexanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-methyl 6-O-[(5-nitroquinolin-8-yl)oxymethyl] hexanedioate?
The IUPAC name of 1-O-methyl 6-O-[(5-nitroquinolin-8-yl)oxymethyl] hexanedioate (CID 149115733) is 1-O-methyl 6-O-[(5-nitroquinolin-8-yl)oxymethyl] hexanedioate.
What is the SMILES notation for 1-O-methyl 6-O-[(5-nitroquinolin-8-yl)oxymethyl] hexanedioate?
The canonical SMILES for 1-O-methyl 6-O-[(5-nitroquinolin-8-yl)oxymethyl] hexanedioate is COC(=O)CCCCC(=O)OCOc1ccc([N+](=O)[O-])c2cccnc12.
What is the InChIKey of 1-O-methyl 6-O-[(5-nitroquinolin-8-yl)oxymethyl] hexanedioate?
The InChIKey is QYIISFBNOMTLEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N2O7/c1-24-15(20)6-2-3-7-16(21)26-11-25-14-9-8-13(19(22)23)12-5-4-10-18-17(12)14/h4-5,8-10H,2-3,6-7,11H2,1H3.
What are the key properties of 1-O-methyl 6-O-[(5-nitroquinolin-8-yl)oxymethyl] hexanedioate?
1-O-methyl 6-O-[(5-nitroquinolin-8-yl)oxymethyl] hexanedioate has a molecular weight of 362.34 g/mol, XLogP of 2.76, 9 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-methyl 6-O-[(5-nitroquinolin-8-yl)oxymethyl] hexanedioate is sourced from PubChem (CID 149115733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).