About (5-nitroquinolin-8-yl) 2-methylprop-2-enoate
(5-nitroquinolin-8-yl) 2-methylprop-2-enoate (PubChem CID 19748562) has the molecular formula C13H10N2O4
and a molecular weight of 258.23 g/mol. Its IUPAC name is (5-nitroquinolin-8-yl) 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | (5-nitroquinolin-8-yl) 2-methylprop-2-enoate |
| PubChem CID | 19748562 |
| Molecular Formula | C13H10N2O4 |
| Molecular Weight | 258.23 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | (5-nitroquinolin-8-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc([N+](=O)[O-])c2cccnc12 |
| InChI | InChI=1S/C13H10N2O4/c1-8(2)13(16)19-11-6-5-10(15(17)18)9-4-3-7-14-12(9)11/h3-7H,1H2,2H3 |
| InChIKey | XGWLDSANPVNSRI-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 82.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.23 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (5-nitroquinolin-8-yl) 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-nitroquinolin-8-yl) 2-methylprop-2-enoate?
The IUPAC name of (5-nitroquinolin-8-yl) 2-methylprop-2-enoate (CID 19748562) is (5-nitroquinolin-8-yl) 2-methylprop-2-enoate.
What is the SMILES notation for (5-nitroquinolin-8-yl) 2-methylprop-2-enoate?
The canonical SMILES for (5-nitroquinolin-8-yl) 2-methylprop-2-enoate is C=C(C)C(=O)Oc1ccc([N+](=O)[O-])c2cccnc12.
What is the InChIKey of (5-nitroquinolin-8-yl) 2-methylprop-2-enoate?
The InChIKey is XGWLDSANPVNSRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2O4/c1-8(2)13(16)19-11-6-5-10(15(17)18)9-4-3-7-14-12(9)11/h3-7H,1H2,2H3.
What are the key properties of (5-nitroquinolin-8-yl) 2-methylprop-2-enoate?
(5-nitroquinolin-8-yl) 2-methylprop-2-enoate has a molecular weight of 258.23 g/mol, XLogP of 2.62, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-nitroquinolin-8-yl) 2-methylprop-2-enoate is sourced from PubChem (CID 19748562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).