About (8-nitroquinolin-5-yl) carbonochloridate
(8-nitroquinolin-5-yl) carbonochloridate (PubChem CID 116525781) has the molecular formula C10H5ClN2O4
and a molecular weight of 252.61 g/mol. Its IUPAC name is (8-nitroquinolin-5-yl) carbonochloridate.
Molecular Properties
| Compound Name | (8-nitroquinolin-5-yl) carbonochloridate |
| PubChem CID | 116525781 |
| Molecular Formula | C10H5ClN2O4 |
| Molecular Weight | 252.61 g/mol |
| Exact Mass | 251.99 |
| IUPAC Name | (8-nitroquinolin-5-yl) carbonochloridate |
| SMILES | O=C(Cl)Oc1ccc([N+](=O)[O-])c2ncccc12 |
| InChI | InChI=1S/C10H5ClN2O4/c11-10(14)17-8-4-3-7(13(15)16)9-6(8)2-1-5-12-9/h1-5H |
| InChIKey | WCMXFHCMXLLREC-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 82.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.61 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (8-nitroquinolin-5-yl) carbonochloridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8-nitroquinolin-5-yl) carbonochloridate?
The IUPAC name of (8-nitroquinolin-5-yl) carbonochloridate (CID 116525781) is (8-nitroquinolin-5-yl) carbonochloridate.
What is the SMILES notation for (8-nitroquinolin-5-yl) carbonochloridate?
The canonical SMILES for (8-nitroquinolin-5-yl) carbonochloridate is O=C(Cl)Oc1ccc([N+](=O)[O-])c2ncccc12.
What is the InChIKey of (8-nitroquinolin-5-yl) carbonochloridate?
The InChIKey is WCMXFHCMXLLREC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5ClN2O4/c11-10(14)17-8-4-3-7(13(15)16)9-6(8)2-1-5-12-9/h1-5H.
What are the key properties of (8-nitroquinolin-5-yl) carbonochloridate?
(8-nitroquinolin-5-yl) carbonochloridate has a molecular weight of 252.61 g/mol, XLogP of 2.88, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (8-nitroquinolin-5-yl) carbonochloridate is sourced from PubChem (CID 116525781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).