About (5-nitroquinolin-8-yl) morpholine-4-carboxylate
(5-nitroquinolin-8-yl) morpholine-4-carboxylate (PubChem CID 175460735) has the molecular formula C14H13N3O5
and a molecular weight of 303.27 g/mol. Its IUPAC name is (5-nitroquinolin-8-yl) morpholine-4-carboxylate.
Molecular Properties
| Compound Name | (5-nitroquinolin-8-yl) morpholine-4-carboxylate |
| PubChem CID | 175460735 |
| Molecular Formula | C14H13N3O5 |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | (5-nitroquinolin-8-yl) morpholine-4-carboxylate |
| SMILES | O=C(Oc1ccc([N+](=O)[O-])c2cccnc12)N1CCOCC1 |
| InChI | InChI=1S/C14H13N3O5/c18-14(16-6-8-21-9-7-16)22-12-4-3-11(17(19)20)10-2-1-5-15-13(10)12/h1-5H,6-9H2 |
| InChIKey | GLQAIXOUKFSHDC-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 94.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (5-nitroquinolin-8-yl) morpholine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-nitroquinolin-8-yl) morpholine-4-carboxylate?
The IUPAC name of (5-nitroquinolin-8-yl) morpholine-4-carboxylate (CID 175460735) is (5-nitroquinolin-8-yl) morpholine-4-carboxylate.
What is the SMILES notation for (5-nitroquinolin-8-yl) morpholine-4-carboxylate?
The canonical SMILES for (5-nitroquinolin-8-yl) morpholine-4-carboxylate is O=C(Oc1ccc([N+](=O)[O-])c2cccnc12)N1CCOCC1.
What is the InChIKey of (5-nitroquinolin-8-yl) morpholine-4-carboxylate?
The InChIKey is GLQAIXOUKFSHDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N3O5/c18-14(16-6-8-21-9-7-16)22-12-4-3-11(17(19)20)10-2-1-5-15-13(10)12/h1-5H,6-9H2.
What are the key properties of (5-nitroquinolin-8-yl) morpholine-4-carboxylate?
(5-nitroquinolin-8-yl) morpholine-4-carboxylate has a molecular weight of 303.27 g/mol, XLogP of 1.97, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (5-nitroquinolin-8-yl) morpholine-4-carboxylate is sourced from PubChem (CID 175460735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).