C17H17N3O6 — CID 146455590
(5-nitroquinolin-8-yl) 1-acetyl-2-methylpyrrolidine-2-carboperoxoate (PubChem CID 146455590) has the molecular formula C17H17N3O6 and a molecular weight of 359.34 g/mol. Its IUPAC name is (5-nitroquinolin-8-yl) 1-acetyl-2-methylpyrrolidine-2-carboperoxoate.
| Compound Name | (5-nitroquinolin-8-yl) 1-acetyl-2-methylpyrrolidine-2-carboperoxoate |
|---|---|
| PubChem CID | 146455590 |
| Molecular Formula | C17H17N3O6 |
| Molecular Weight | 359.34 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | (5-nitroquinolin-8-yl) 1-acetyl-2-methylpyrrolidine-2-carboperoxoate |
| SMILES | CC(=O)N1CCCC1(C)C(=O)OOc1ccc([N+](=O)[O-])c2cccnc12 |
| InChI | InChI=1S/C17H17N3O6/c1-11(21)19-10-4-8-17(19,2)16(22)26-25-14-7-6-13(20(23)24)12-5-3-9-18-15(12)14/h3,5-7,9H,4,8,10H2,1-2H3 |
| InChIKey | VXAMMNBDRLGCQM-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 111.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.34 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|