C24H25N3O7 — CID 146455526
(5-nitroquinolin-8-yl) 2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropaneperoxoate (PubChem CID 146455526) has the molecular formula C24H25N3O7 and a molecular weight of 467.48 g/mol. Its IUPAC name is (5-nitroquinolin-8-yl) 2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropaneperoxoate.
| Compound Name | (5-nitroquinolin-8-yl) 2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropaneperoxoate |
|---|---|
| PubChem CID | 146455526 |
| Molecular Formula | C24H25N3O7 |
| Molecular Weight | 467.48 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | (5-nitroquinolin-8-yl) 2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropaneperoxoate |
| SMILES | CC(C)(C)OC(=O)NC(C)(Cc1ccccc1)C(=O)OOc1ccc([N+](=O)[O-])c2cccnc12 |
| InChI | InChI=1S/C24H25N3O7/c1-23(2,3)32-22(29)26-24(4,15-16-9-6-5-7-10-16)21(28)34-33-19-13-12-18(27(30)31)17-11-8-14-25-20(17)19/h5-14H,15H2,1-4H3,(H,26,29) |
| InChIKey | AAROADIDONBODI-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 129.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.48 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|