C17H23N5O4 — CID 68933218
tert-butyl N-[2-methyl-1-[(3-nitro-1,5-naphthyridin-4-yl)amino]propan-2-yl]carbamate (PubChem CID 68933218) has the molecular formula C17H23N5O4 and a molecular weight of 361.40 g/mol. Its IUPAC name is tert-butyl N-[2-methyl-1-[(3-nitro-1,5-naphthyridin-4-yl)amino]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[2-methyl-1-[(3-nitro-1,5-naphthyridin-4-yl)amino]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 68933218 |
| Molecular Formula | C17H23N5O4 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | tert-butyl N-[2-methyl-1-[(3-nitro-1,5-naphthyridin-4-yl)amino]propan-2-yl]carbamate |
| SMILES | CC(C)(CNc1c([N+](=O)[O-])cnc2cccnc12)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H23N5O4/c1-16(2,3)26-15(23)21-17(4,5)10-20-14-12(22(24)25)9-19-11-7-6-8-18-13(11)14/h6-9H,10H2,1-5H3,(H,19,20)(H,21,23) |
| InChIKey | BXLJANLFUNFCPZ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 119.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|