C14H15BrN4O4 — CID 68818638
[1-[(7-bromo-3-nitroquinolin-4-yl)amino]-2-methylpropan-2-yl]carbamic acid (PubChem CID 68818638) has the molecular formula C14H15BrN4O4 and a molecular weight of 383.20 g/mol. Its IUPAC name is [1-[(7-bromo-3-nitroquinolin-4-yl)amino]-2-methylpropan-2-yl]carbamic acid.
| Compound Name | [1-[(7-bromo-3-nitroquinolin-4-yl)amino]-2-methylpropan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 68818638 |
| Molecular Formula | C14H15BrN4O4 |
| Molecular Weight | 383.20 g/mol |
| Exact Mass | 382.03 |
| IUPAC Name | [1-[(7-bromo-3-nitroquinolin-4-yl)amino]-2-methylpropan-2-yl]carbamic acid |
| SMILES | CC(C)(CNc1c([N+](=O)[O-])cnc2cc(Br)ccc12)NC(=O)O |
| InChI | InChI=1S/C14H15BrN4O4/c1-14(2,18-13(20)21)7-17-12-9-4-3-8(15)5-10(9)16-6-11(12)19(22)23/h3-6,18H,7H2,1-2H3,(H,16,17)(H,20,21) |
| InChIKey | RDEXPRLMKBNCAE-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 117.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.20 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|