C14H15N3O6 — CID 122060772
2-hydroxy-3-[(7-methoxy-3-nitroquinolin-4-yl)amino]-2-methylpropanoic acid (PubChem CID 122060772) has the molecular formula C14H15N3O6 and a molecular weight of 321.29 g/mol. Its IUPAC name is 2-hydroxy-3-[(7-methoxy-3-nitroquinolin-4-yl)amino]-2-methylpropanoic acid.
| Compound Name | 2-hydroxy-3-[(7-methoxy-3-nitroquinolin-4-yl)amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 122060772 |
| Molecular Formula | C14H15N3O6 |
| Molecular Weight | 321.29 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 2-hydroxy-3-[(7-methoxy-3-nitroquinolin-4-yl)amino]-2-methylpropanoic acid |
| SMILES | COc1ccc2c(NCC(C)(O)C(=O)O)c([N+](=O)[O-])cnc2c1 |
| InChI | InChI=1S/C14H15N3O6/c1-14(20,13(18)19)7-16-12-9-4-3-8(23-2)5-10(9)15-6-11(12)17(21)22/h3-6,20H,7H2,1-2H3,(H,15,16)(H,18,19) |
| InChIKey | FEURVBLBRHLEMP-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 134.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.29 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|