C17H14N4O4 — CID 174160363
[3-[[(3-nitroquinolin-4-yl)amino]methyl]phenyl]carbamic acid (PubChem CID 174160363) has the molecular formula C17H14N4O4 and a molecular weight of 338.32 g/mol. Its IUPAC name is [3-[[(3-nitroquinolin-4-yl)amino]methyl]phenyl]carbamic acid.
| Compound Name | [3-[[(3-nitroquinolin-4-yl)amino]methyl]phenyl]carbamic acid |
|---|---|
| PubChem CID | 174160363 |
| Molecular Formula | C17H14N4O4 |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | [3-[[(3-nitroquinolin-4-yl)amino]methyl]phenyl]carbamic acid |
| SMILES | O=C(O)Nc1cccc(CNc2c([N+](=O)[O-])cnc3ccccc23)c1 |
| InChI | InChI=1S/C17H14N4O4/c22-17(23)20-12-5-3-4-11(8-12)9-19-16-13-6-1-2-7-14(13)18-10-15(16)21(24)25/h1-8,10,20H,9H2,(H,18,19)(H,22,23) |
| InChIKey | GJISSSSJFVDFOC-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 117.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|