C21H24N4O2 — CID 164926469
tert-butyl N-[3-[[(3-aminoquinolin-4-yl)amino]methyl]phenyl]carbamate (PubChem CID 164926469) has the molecular formula C21H24N4O2 and a molecular weight of 364.45 g/mol. Its IUPAC name is tert-butyl N-[3-[[(3-aminoquinolin-4-yl)amino]methyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[3-[[(3-aminoquinolin-4-yl)amino]methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 164926469 |
| Molecular Formula | C21H24N4O2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | tert-butyl N-[3-[[(3-aminoquinolin-4-yl)amino]methyl]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cccc(CNc2c(N)cnc3ccccc23)c1 |
| InChI | InChI=1S/C21H24N4O2/c1-21(2,3)27-20(26)25-15-8-6-7-14(11-15)12-24-19-16-9-4-5-10-18(16)23-13-17(19)22/h4-11,13H,12,22H2,1-3H3,(H,23,24)(H,25,26) |
| InChIKey | RNFZLRWAOMCYOU-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |