C26H32N4O3 — CID 164926450
tert-butyl N-[4-[[[3-(pentanoylamino)quinolin-4-yl]amino]methyl]phenyl]carbamate (PubChem CID 164926450) has the molecular formula C26H32N4O3 and a molecular weight of 448.57 g/mol. Its IUPAC name is tert-butyl N-[4-[[[3-(pentanoylamino)quinolin-4-yl]amino]methyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[[[3-(pentanoylamino)quinolin-4-yl]amino]methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 164926450 |
| Molecular Formula | C26H32N4O3 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | tert-butyl N-[4-[[[3-(pentanoylamino)quinolin-4-yl]amino]methyl]phenyl]carbamate |
| SMILES | CCCCC(=O)Nc1cnc2ccccc2c1NCc1ccc(NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C26H32N4O3/c1-5-6-11-23(31)30-22-17-27-21-10-8-7-9-20(21)24(22)28-16-18-12-14-19(15-13-18)29-25(32)33-26(2,3)4/h7-10,12-15,17H,5-6,11,16H2,1-4H3,(H,27,28)(H,29,32)(H,30,31) |
| InChIKey | OBHJKYANHUSMHJ-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |