C22H24N2O2S — CID 18790543
tert-butyl N-[4-(2-quinolin-4-ylsulfanylethyl)phenyl]carbamate (PubChem CID 18790543) has the molecular formula C22H24N2O2S and a molecular weight of 380.51 g/mol. Its IUPAC name is tert-butyl N-[4-(2-quinolin-4-ylsulfanylethyl)phenyl]carbamate.
| Compound Name | tert-butyl N-[4-(2-quinolin-4-ylsulfanylethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 18790543 |
| Molecular Formula | C22H24N2O2S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | tert-butyl N-[4-(2-quinolin-4-ylsulfanylethyl)phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(CCSc2ccnc3ccccc23)cc1 |
| InChI | InChI=1S/C22H24N2O2S/c1-22(2,3)26-21(25)24-17-10-8-16(9-11-17)13-15-27-20-12-14-23-19-7-5-4-6-18(19)20/h4-12,14H,13,15H2,1-3H3,(H,24,25) |
| InChIKey | IUNPPDXCHLGMBG-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |