C34H47NO2SSi — CID 46866943
tert-butyl N-[4-[4-[4-[2-tri(propan-2-yl)silylsulfanylethyl]phenyl]phenyl]phenyl]carbamate (PubChem CID 46866943) has the molecular formula C34H47NO2SSi and a molecular weight of 561.91 g/mol. Its IUPAC name is tert-butyl N-[4-[4-[4-[2-tri(propan-2-yl)silylsulfanylethyl]phenyl]phenyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[4-[4-[2-tri(propan-2-yl)silylsulfanylethyl]phenyl]phenyl]phenyl]carbamate |
|---|---|
| PubChem CID | 46866943 |
| Molecular Formula | C34H47NO2SSi |
| Molecular Weight | 561.91 g/mol |
| Exact Mass | 561.31 |
| IUPAC Name | tert-butyl N-[4-[4-[4-[2-tri(propan-2-yl)silylsulfanylethyl]phenyl]phenyl]phenyl]carbamate |
| SMILES | CC(C)[Si](SCCc1ccc(-c2ccc(-c3ccc(NC(=O)OC(C)(C)C)cc3)cc2)cc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C34H47NO2SSi/c1-24(2)39(25(3)4,26(5)6)38-23-22-27-10-12-28(13-11-27)29-14-16-30(17-15-29)31-18-20-32(21-19-31)35-33(36)37-34(7,8)9/h10-21,24-26H,22-23H2,1-9H3,(H,35,36) |
| InChIKey | DNGMBTFIGSXROP-UHFFFAOYSA-N |
| XLogP | 10.82 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.91 |
| LogP ≤ 5 | 10.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|