C22H29N3O5 — CID 140783484
tert-butyl N-[4-[[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]methyl]phenyl]carbamate (PubChem CID 140783484) has the molecular formula C22H29N3O5 and a molecular weight of 415.49 g/mol. Its IUPAC name is tert-butyl N-[4-[[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]methyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 140783484 |
| Molecular Formula | C22H29N3O5 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | tert-butyl N-[4-[[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]methyl]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(CNC(=O)CCCCCN2C(=O)C=CC2=O)cc1 |
| InChI | InChI=1S/C22H29N3O5/c1-22(2,3)30-21(29)24-17-10-8-16(9-11-17)15-23-18(26)7-5-4-6-14-25-19(27)12-13-20(25)28/h8-13H,4-7,14-15H2,1-3H3,(H,23,26)(H,24,29) |
| InChIKey | BCJXWCGNMPLGCQ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|