C27H30N4O5 — CID 155418149
6-(2,5-dioxopyrrol-1-yl)-N-[[4-[[(2S)-2-formamido-3-phenylpropanoyl]amino]phenyl]methyl]hexanamide (PubChem CID 155418149) has the molecular formula C27H30N4O5 and a molecular weight of 490.56 g/mol. Its IUPAC name is 6-(2,5-dioxopyrrol-1-yl)-N-[[4-[[(2S)-2-formamido-3-phenylpropanoyl]amino]phenyl]methyl]hexanamide.
| Compound Name | 6-(2,5-dioxopyrrol-1-yl)-N-[[4-[[(2S)-2-formamido-3-phenylpropanoyl]amino]phenyl]methyl]hexanamide |
|---|---|
| PubChem CID | 155418149 |
| Molecular Formula | C27H30N4O5 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | 6-(2,5-dioxopyrrol-1-yl)-N-[[4-[[(2S)-2-formamido-3-phenylpropanoyl]amino]phenyl]methyl]hexanamide |
| SMILES | O=CN[C@@H](Cc1ccccc1)C(=O)Nc1ccc(CNC(=O)CCCCCN2C(=O)C=CC2=O)cc1 |
| InChI | InChI=1S/C27H30N4O5/c32-19-29-23(17-20-7-3-1-4-8-20)27(36)30-22-12-10-21(11-13-22)18-28-24(33)9-5-2-6-16-31-25(34)14-15-26(31)35/h1,3-4,7-8,10-15,19,23H,2,5-6,9,16-18H2,(H,28,33)(H,29,32)(H,30,36)/t23-/m0/s1 |
| InChIKey | AOHZLJQHMNIKCG-QHCPKHFHSA-N |
| XLogP | 2.08 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|