C37H46ClN5O9 — CID 155207280
[4-[[(2S)-2-[[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-phenylpropanoyl]amino]-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]phenyl]methyl carbonochloridate (PubChem CID 155207280) has the molecular formula C37H46ClN5O9 and a molecular weight of 740.25 g/mol. Its IUPAC name is [4-[[(2S)-2-[[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-phenylpropanoyl]amino]-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]phenyl]methyl carbonochloridate.
| Compound Name | [4-[[(2S)-2-[[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-phenylpropanoyl]amino]-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]phenyl]methyl carbonochloridate |
|---|---|
| PubChem CID | 155207280 |
| Molecular Formula | C37H46ClN5O9 |
| Molecular Weight | 740.25 g/mol |
| Exact Mass | 739.30 |
| IUPAC Name | [4-[[(2S)-2-[[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-phenylpropanoyl]amino]-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]phenyl]methyl carbonochloridate |
| SMILES | CC(C)(C)OC(=O)NCCC[C@H](NC(=O)C(Cc1ccccc1)NC(=O)CCCCCN1C(=O)C=CC1=O)C(=O)Nc1ccc(COC(=O)Cl)cc1 |
| InChI | InChI=1S/C37H46ClN5O9/c1-37(2,3)52-36(50)39-21-10-13-28(33(47)40-27-17-15-26(16-18-27)24-51-35(38)49)42-34(48)29(23-25-11-6-4-7-12-25)41-30(44)14-8-5-9-22-43-31(45)19-20-32(43)46/h4,6-7,11-12,15-20,28-29H,5,8-10,13-14,21-24H2,1-3H3,(H,39,50)(H,40,47)(H,41,44)(H,42,48)/t28-,29?/m0/s1 |
| InChIKey | WHHJXWDCNNHXEY-XLTVJXRZSA-N |
| XLogP | 4.50 |
| TPSA | 189.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.25 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|