C31H46N6O9 — CID 146555761
[4-[[(2S)-5-[[amino(hydroxy)methyl]amino]-2-[[(2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-hydroxypropanoyl]amino]pentanoyl]amino]phenyl]methyl 2,2-dimethylpropanoate (PubChem CID 146555761) has the molecular formula C31H46N6O9 and a molecular weight of 646.74 g/mol. Its IUPAC name is [4-[[(2S)-5-[[amino(hydroxy)methyl]amino]-2-[[(2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-hydroxypropanoyl]amino]pentanoyl]amino]phenyl]methyl 2,2-dimethylpropanoate.
| Compound Name | [4-[[(2S)-5-[[amino(hydroxy)methyl]amino]-2-[[(2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-hydroxypropanoyl]amino]pentanoyl]amino]phenyl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 146555761 |
| Molecular Formula | C31H46N6O9 |
| Molecular Weight | 646.74 g/mol |
| Exact Mass | 646.33 |
| IUPAC Name | [4-[[(2S)-5-[[amino(hydroxy)methyl]amino]-2-[[(2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-hydroxypropanoyl]amino]pentanoyl]amino]phenyl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCc1ccc(NC(=O)[C@H](CCCNC(N)O)NC(=O)[C@H](CO)NC(=O)CCCCCN2C(=O)C=CC2=O)cc1 |
| InChI | InChI=1S/C31H46N6O9/c1-31(2,3)29(44)46-19-20-10-12-21(13-11-20)34-27(42)22(8-7-16-33-30(32)45)36-28(43)23(18-38)35-24(39)9-5-4-6-17-37-25(40)14-15-26(37)41/h10-15,22-23,30,33,38,45H,4-9,16-19,32H2,1-3H3,(H,34,42)(H,35,39)(H,36,43)/t22-,23-,30?/m0/s1 |
| InChIKey | FNOJGCHHQWCCCN-ADQBINQZSA-N |
| XLogP | -0.23 |
| TPSA | 229.49 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.74 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|