C28H37N7O9S — CID 138512709
[4-[[(2S)-2-[[(2S)-4-amino-2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-4-oxobutanoyl]amino]-5-(carbamoylamino)pentanoyl]amino]phenyl]methyl 2-methyl-2-sulfanylpropanoate (PubChem CID 138512709) has the molecular formula C28H37N7O9S and a molecular weight of 647.71 g/mol. Its IUPAC name is [4-[[(2S)-2-[[(2S)-4-amino-2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-4-oxobutanoyl]amino]-5-(carbamoylamino)pentanoyl]amino]phenyl]methyl 2-methyl-2-sulfanylpropanoate.
| Compound Name | [4-[[(2S)-2-[[(2S)-4-amino-2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-4-oxobutanoyl]amino]-5-(carbamoylamino)pentanoyl]amino]phenyl]methyl 2-methyl-2-sulfanylpropanoate |
|---|---|
| PubChem CID | 138512709 |
| Molecular Formula | C28H37N7O9S |
| Molecular Weight | 647.71 g/mol |
| Exact Mass | 647.24 |
| IUPAC Name | [4-[[(2S)-2-[[(2S)-4-amino-2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-4-oxobutanoyl]amino]-5-(carbamoylamino)pentanoyl]amino]phenyl]methyl 2-methyl-2-sulfanylpropanoate |
| SMILES | CC(C)(S)C(=O)OCc1ccc(NC(=O)[C@H](CCCNC(N)=O)NC(=O)[C@H](CC(N)=O)NC(=O)CCN2C(=O)C=CC2=O)cc1 |
| InChI | InChI=1S/C28H37N7O9S/c1-28(2,45)26(42)44-15-16-5-7-17(8-6-16)32-24(40)18(4-3-12-31-27(30)43)34-25(41)19(14-20(29)36)33-21(37)11-13-35-22(38)9-10-23(35)39/h5-10,18-19,45H,3-4,11-15H2,1-2H3,(H2,29,36)(H,32,40)(H,33,37)(H,34,41)(H3,30,31,43)/t18-,19-/m0/s1 |
| InChIKey | JJPABEAUNQTFRX-OALUTQOASA-N |
| XLogP | -1.01 |
| TPSA | 249.19 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.71 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|