C28H39N7O9 — CID 162430896
[4-[[(2S)-2-[[(2S)-4-amino-2-[3-(2-hydroxy-5-oxo-2H-pyrrol-1-yl)propanoylamino]-4-oxobutanoyl]amino]-5-(carbamoylamino)pentanoyl]amino]phenyl]methyl 2-methylpropanoate (PubChem CID 162430896) has the molecular formula C28H39N7O9 and a molecular weight of 617.66 g/mol. Its IUPAC name is [4-[[(2S)-2-[[(2S)-4-amino-2-[3-(2-hydroxy-5-oxo-2H-pyrrol-1-yl)propanoylamino]-4-oxobutanoyl]amino]-5-(carbamoylamino)pentanoyl]amino]phenyl]methyl 2-methylpropanoate.
| Compound Name | [4-[[(2S)-2-[[(2S)-4-amino-2-[3-(2-hydroxy-5-oxo-2H-pyrrol-1-yl)propanoylamino]-4-oxobutanoyl]amino]-5-(carbamoylamino)pentanoyl]amino]phenyl]methyl 2-methylpropanoate |
|---|---|
| PubChem CID | 162430896 |
| Molecular Formula | C28H39N7O9 |
| Molecular Weight | 617.66 g/mol |
| Exact Mass | 617.28 |
| IUPAC Name | [4-[[(2S)-2-[[(2S)-4-amino-2-[3-(2-hydroxy-5-oxo-2H-pyrrol-1-yl)propanoylamino]-4-oxobutanoyl]amino]-5-(carbamoylamino)pentanoyl]amino]phenyl]methyl 2-methylpropanoate |
| SMILES | CC(C)C(=O)OCc1ccc(NC(=O)[C@H](CCCNC(N)=O)NC(=O)[C@H](CC(N)=O)NC(=O)CCN2C(=O)C=CC2O)cc1 |
| InChI | InChI=1S/C28H39N7O9/c1-16(2)27(42)44-15-17-5-7-18(8-6-17)32-25(40)19(4-3-12-31-28(30)43)34-26(41)20(14-21(29)36)33-22(37)11-13-35-23(38)9-10-24(35)39/h5-10,16,19-20,23,38H,3-4,11-15H2,1-2H3,(H2,29,36)(H,32,40)(H,33,37)(H,34,41)(H3,30,31,43)/t19-,20-,23?/m0/s1 |
| InChIKey | GUMFHVPIFQTDDE-ZXTYOHMPSA-N |
| XLogP | -1.28 |
| TPSA | 252.35 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.66 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|