C29H40N6O8 — CID 154940487
[4-[[5-(carbamoylamino)-2-[[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]acetyl]amino]pentanoyl]amino]phenyl]methyl butanoate (PubChem CID 154940487) has the molecular formula C29H40N6O8 and a molecular weight of 600.67 g/mol. Its IUPAC name is [4-[[5-(carbamoylamino)-2-[[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]acetyl]amino]pentanoyl]amino]phenyl]methyl butanoate.
| Compound Name | [4-[[5-(carbamoylamino)-2-[[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]acetyl]amino]pentanoyl]amino]phenyl]methyl butanoate |
|---|---|
| PubChem CID | 154940487 |
| Molecular Formula | C29H40N6O8 |
| Molecular Weight | 600.67 g/mol |
| Exact Mass | 600.29 |
| IUPAC Name | [4-[[5-(carbamoylamino)-2-[[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]acetyl]amino]pentanoyl]amino]phenyl]methyl butanoate |
| SMILES | CCCC(=O)OCc1ccc(NC(=O)C(CCCNC(N)=O)NC(=O)CNC(=O)CCCCCN2C(=O)C=CC2=O)cc1 |
| InChI | InChI=1S/C29H40N6O8/c1-2-7-27(40)43-19-20-10-12-21(13-11-20)33-28(41)22(8-6-16-31-29(30)42)34-24(37)18-32-23(36)9-4-3-5-17-35-25(38)14-15-26(35)39/h10-15,22H,2-9,16-19H2,1H3,(H,32,36)(H,33,41)(H,34,37)(H3,30,31,42) |
| InChIKey | RHVDKKMIPRRVEI-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 206.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.67 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|