C21H35N5O7 — CID 156647066
5-(carbamoylamino)-2-[[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]acetyl]amino]pentanoic acid;propane (PubChem CID 156647066) has the molecular formula C21H35N5O7 and a molecular weight of 469.54 g/mol. Its IUPAC name is 5-(carbamoylamino)-2-[[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]acetyl]amino]pentanoic acid;propane.
| Compound Name | 5-(carbamoylamino)-2-[[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]acetyl]amino]pentanoic acid;propane |
|---|---|
| PubChem CID | 156647066 |
| Molecular Formula | C21H35N5O7 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.25 |
| IUPAC Name | 5-(carbamoylamino)-2-[[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]acetyl]amino]pentanoic acid;propane |
| SMILES | CCC.NC(=O)NCCCC(NC(=O)CNC(=O)CCCCCN1C(=O)C=CC1=O)C(=O)O |
| InChI | InChI=1S/C18H27N5O7.C3H8/c19-18(30)20-9-4-5-12(17(28)29)22-14(25)11-21-13(24)6-2-1-3-10-23-15(26)7-8-16(23)27;1-3-2/h7-8,12H,1-6,9-11H2,(H,21,24)(H,22,25)(H,28,29)(H3,19,20,30);3H2,1-2H3 |
| InChIKey | WGZOYHWZVMEZLS-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 188.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|