C25H39N5O7 — CID 167499696
acetylene;N-[1-[[(4S)-1-(carbamoylamino)-6,6-dimethyl-5-oxoheptan-4-yl]amino]-3-hydroxy-1-oxopropan-2-yl]-6-(2,5-dioxopyrrol-1-yl)hexanamide (PubChem CID 167499696) has the molecular formula C25H39N5O7 and a molecular weight of 521.62 g/mol. Its IUPAC name is acetylene;N-[1-[[(4S)-1-(carbamoylamino)-6,6-dimethyl-5-oxoheptan-4-yl]amino]-3-hydroxy-1-oxopropan-2-yl]-6-(2,5-dioxopyrrol-1-yl)hexanamide.
| Compound Name | acetylene;N-[1-[[(4S)-1-(carbamoylamino)-6,6-dimethyl-5-oxoheptan-4-yl]amino]-3-hydroxy-1-oxopropan-2-yl]-6-(2,5-dioxopyrrol-1-yl)hexanamide |
|---|---|
| PubChem CID | 167499696 |
| Molecular Formula | C25H39N5O7 |
| Molecular Weight | 521.62 g/mol |
| Exact Mass | 521.28 |
| IUPAC Name | acetylene;N-[1-[[(4S)-1-(carbamoylamino)-6,6-dimethyl-5-oxoheptan-4-yl]amino]-3-hydroxy-1-oxopropan-2-yl]-6-(2,5-dioxopyrrol-1-yl)hexanamide |
| SMILES | C#C.CC(C)(C)C(=O)[C@H](CCCNC(N)=O)NC(=O)C(CO)NC(=O)CCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C23H37N5O7.C2H2/c1-23(2,3)20(33)15(8-7-12-25-22(24)35)27-21(34)16(14-29)26-17(30)9-5-4-6-13-28-18(31)10-11-19(28)32;1-2/h10-11,15-16,29H,4-9,12-14H2,1-3H3,(H,26,30)(H,27,34)(H3,24,25,35);1-2H/t15-,16?;/m0./s1 |
| InChIKey | RNVHKFROKNJPBV-VPVGQWTESA-N |
| XLogP | -0.25 |
| TPSA | 188.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.62 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|