C22H39N5O7 — CID 145323293
6-(2,5-dioxopyrrol-1-yl)-N-[3-hydroxy-1-oxo-1-(2-oxopropylamino)propan-2-yl]hexanamide;ethane;propylurea (PubChem CID 145323293) has the molecular formula C22H39N5O7 and a molecular weight of 485.58 g/mol. Its IUPAC name is 6-(2,5-dioxopyrrol-1-yl)-N-[3-hydroxy-1-oxo-1-(2-oxopropylamino)propan-2-yl]hexanamide;ethane;propylurea.
| Compound Name | 6-(2,5-dioxopyrrol-1-yl)-N-[3-hydroxy-1-oxo-1-(2-oxopropylamino)propan-2-yl]hexanamide;ethane;propylurea |
|---|---|
| PubChem CID | 145323293 |
| Molecular Formula | C22H39N5O7 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.28 |
| IUPAC Name | 6-(2,5-dioxopyrrol-1-yl)-N-[3-hydroxy-1-oxo-1-(2-oxopropylamino)propan-2-yl]hexanamide;ethane;propylurea |
| SMILES | CC.CC(=O)CNC(=O)C(CO)NC(=O)CCCCCN1C(=O)C=CC1=O.CCCNC(N)=O |
| InChI | InChI=1S/C16H23N3O6.C4H10N2O.C2H6/c1-11(21)9-17-16(25)12(10-20)18-13(22)5-3-2-4-8-19-14(23)6-7-15(19)24;1-2-3-6-4(5)7;1-2/h6-7,12,20H,2-5,8-10H2,1H3,(H,17,25)(H,18,22);2-3H2,1H3,(H3,5,6,7);1-2H3 |
| InChIKey | OCLPYODVVOUAET-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 188.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|