C13H17N3O5 — CID 129198548
2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-N-(2-oxopropyl)propanamide (PubChem CID 129198548) has the molecular formula C13H17N3O5 and a molecular weight of 295.30 g/mol. Its IUPAC name is 2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-N-(2-oxopropyl)propanamide.
| Compound Name | 2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-N-(2-oxopropyl)propanamide |
|---|---|
| PubChem CID | 129198548 |
| Molecular Formula | C13H17N3O5 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-N-(2-oxopropyl)propanamide |
| SMILES | CC(=O)CNC(=O)C(C)NC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C13H17N3O5/c1-8(17)7-14-13(21)9(2)15-10(18)5-6-16-11(19)3-4-12(16)20/h3-4,9H,5-7H2,1-2H3,(H,14,21)(H,15,18) |
| InChIKey | VGFZEDLSIAWEAI-UHFFFAOYSA-N |
| XLogP | -1.49 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|