C17H25N5O8 — CID 171536044
3-[[2-[[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]acetyl]amino]propanoylamino]methoxy]-2-hydroxy-2-methylpropanamide (PubChem CID 171536044) has the molecular formula C17H25N5O8 and a molecular weight of 427.41 g/mol. Its IUPAC name is 3-[[2-[[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]acetyl]amino]propanoylamino]methoxy]-2-hydroxy-2-methylpropanamide.
| Compound Name | 3-[[2-[[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]acetyl]amino]propanoylamino]methoxy]-2-hydroxy-2-methylpropanamide |
|---|---|
| PubChem CID | 171536044 |
| Molecular Formula | C17H25N5O8 |
| Molecular Weight | 427.41 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | 3-[[2-[[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]acetyl]amino]propanoylamino]methoxy]-2-hydroxy-2-methylpropanamide |
| SMILES | CC(NC(=O)CNC(=O)CCN1C(=O)C=CC1=O)C(=O)NCOCC(C)(O)C(N)=O |
| InChI | InChI=1S/C17H25N5O8/c1-10(15(27)20-9-30-8-17(2,29)16(18)28)21-12(24)7-19-11(23)5-6-22-13(25)3-4-14(22)26/h3-4,10,29H,5-9H2,1-2H3,(H2,18,28)(H,19,23)(H,20,27)(H,21,24) |
| InChIKey | AJFCSVLEGNWUCC-UHFFFAOYSA-N |
| XLogP | -3.75 |
| TPSA | 197.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.41 |
| LogP ≤ 5 | -3.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|