C21H32N4O7 — CID 174218902
butyl 2-[[2-[[6-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-6-oxohexanoyl]amino]acetyl]amino]propanoate (PubChem CID 174218902) has the molecular formula C21H32N4O7 and a molecular weight of 452.51 g/mol. Its IUPAC name is butyl 2-[[2-[[6-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-6-oxohexanoyl]amino]acetyl]amino]propanoate.
| Compound Name | butyl 2-[[2-[[6-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-6-oxohexanoyl]amino]acetyl]amino]propanoate |
|---|---|
| PubChem CID | 174218902 |
| Molecular Formula | C21H32N4O7 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | butyl 2-[[2-[[6-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-6-oxohexanoyl]amino]acetyl]amino]propanoate |
| SMILES | CCCCOC(=O)C(C)NC(=O)CNC(=O)CCCCC(=O)NCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C21H32N4O7/c1-3-4-13-32-21(31)15(2)24-18(28)14-23-17(27)8-6-5-7-16(26)22-11-12-25-19(29)9-10-20(25)30/h9-10,15H,3-8,11-14H2,1-2H3,(H,22,26)(H,23,27)(H,24,28) |
| InChIKey | KEUODENMCGQSCV-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 150.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|