C13H20N4O4 — CID 146490463
N-[(2R)-5-(carbamoylamino)pentan-2-yl]-3-(2,5-dioxopyrrol-1-yl)propanamide (PubChem CID 146490463) has the molecular formula C13H20N4O4 and a molecular weight of 296.33 g/mol. Its IUPAC name is N-[(2R)-5-(carbamoylamino)pentan-2-yl]-3-(2,5-dioxopyrrol-1-yl)propanamide.
| Compound Name | N-[(2R)-5-(carbamoylamino)pentan-2-yl]-3-(2,5-dioxopyrrol-1-yl)propanamide |
|---|---|
| PubChem CID | 146490463 |
| Molecular Formula | C13H20N4O4 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | N-[(2R)-5-(carbamoylamino)pentan-2-yl]-3-(2,5-dioxopyrrol-1-yl)propanamide |
| SMILES | C[C@H](CCCNC(N)=O)NC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C13H20N4O4/c1-9(3-2-7-15-13(14)21)16-10(18)6-8-17-11(19)4-5-12(17)20/h4-5,9H,2-3,6-8H2,1H3,(H,16,18)(H3,14,15,21)/t9-/m1/s1 |
| InChIKey | DEPWRVVUFZWQNE-SECBINFHSA-N |
| XLogP | -0.75 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|