C21H27N3O7 — CID 175419965
2-amino-3-phenylpropanoic acid;2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]acetic acid (PubChem CID 175419965) has the molecular formula C21H27N3O7 and a molecular weight of 433.46 g/mol. Its IUPAC name is 2-amino-3-phenylpropanoic acid;2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]acetic acid.
| Compound Name | 2-amino-3-phenylpropanoic acid;2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]acetic acid |
|---|---|
| PubChem CID | 175419965 |
| Molecular Formula | C21H27N3O7 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | 2-amino-3-phenylpropanoic acid;2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]acetic acid |
| SMILES | NC(Cc1ccccc1)C(=O)O.O=C(O)CNC(=O)CCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C12H16N2O5.C9H11NO2/c15-9(13-8-12(18)19)4-2-1-3-7-14-10(16)5-6-11(14)17;10-8(9(11)12)6-7-4-2-1-3-5-7/h5-6H,1-4,7-8H2,(H,13,15)(H,18,19);1-5,8H,6,10H2,(H,11,12) |
| InChIKey | UPDYHYLYBKRYSH-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 167.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|