C19H22N2O5 — CID 160773288
(2S)-2-amino-3-phenylpropanoic acid;2-[(2-phenylacetyl)amino]acetic acid (PubChem CID 160773288) has the molecular formula C19H22N2O5 and a molecular weight of 358.39 g/mol. Its IUPAC name is (2S)-2-amino-3-phenylpropanoic acid;2-[(2-phenylacetyl)amino]acetic acid.
| Compound Name | (2S)-2-amino-3-phenylpropanoic acid;2-[(2-phenylacetyl)amino]acetic acid |
|---|---|
| PubChem CID | 160773288 |
| Molecular Formula | C19H22N2O5 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | (2S)-2-amino-3-phenylpropanoic acid;2-[(2-phenylacetyl)amino]acetic acid |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)O.O=C(O)CNC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C10H11NO3.C9H11NO2/c12-9(11-7-10(13)14)6-8-4-2-1-3-5-8;10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5H,6-7H2,(H,11,12)(H,13,14);1-5,8H,6,10H2,(H,11,12)/t;8-/m.0/s1 |
| InChIKey | RZPKXTLJVZIRND-WDBKTSHHSA-N |
| XLogP | 1.07 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |