C18H26N4O2 — CID 171035159
tert-butyl 2-amino-5-[(3-aminoquinolin-4-yl)amino]pentanoate (PubChem CID 171035159) has the molecular formula C18H26N4O2 and a molecular weight of 330.43 g/mol. Its IUPAC name is tert-butyl 2-amino-5-[(3-aminoquinolin-4-yl)amino]pentanoate.
| Compound Name | tert-butyl 2-amino-5-[(3-aminoquinolin-4-yl)amino]pentanoate |
|---|---|
| PubChem CID | 171035159 |
| Molecular Formula | C18H26N4O2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | tert-butyl 2-amino-5-[(3-aminoquinolin-4-yl)amino]pentanoate |
| SMILES | CC(C)(C)OC(=O)C(N)CCCNc1c(N)cnc2ccccc12 |
| InChI | InChI=1S/C18H26N4O2/c1-18(2,3)24-17(23)13(19)8-6-10-21-16-12-7-4-5-9-15(12)22-11-14(16)20/h4-5,7,9,11,13H,6,8,10,19-20H2,1-3H3,(H,21,22) |
| InChIKey | AAFZNYQCXRZCQS-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|