C11H11N3O2 — CID 103963211
2-[(3-aminoquinolin-4-yl)amino]acetic acid (PubChem CID 103963211) has the molecular formula C11H11N3O2 and a molecular weight of 217.23 g/mol. Its IUPAC name is 2-[(3-aminoquinolin-4-yl)amino]acetic acid.
| Compound Name | 2-[(3-aminoquinolin-4-yl)amino]acetic acid |
|---|---|
| PubChem CID | 103963211 |
| Molecular Formula | C11H11N3O2 |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 2-[(3-aminoquinolin-4-yl)amino]acetic acid |
| SMILES | Nc1cnc2ccccc2c1NCC(=O)O |
| InChI | InChI=1S/C11H11N3O2/c12-8-5-13-9-4-2-1-3-7(9)11(8)14-6-10(15)16/h1-5H,6,12H2,(H,13,14)(H,15,16) |
| InChIKey | PEFQHHHITRWYQG-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |