C10H12N3OP — CID 58294727
4-N-(phosphanyloxymethyl)quinoline-3,4-diamine (PubChem CID 58294727) has the molecular formula C10H12N3OP and a molecular weight of 221.20 g/mol. Its IUPAC name is 4-N-(phosphanyloxymethyl)quinoline-3,4-diamine.
| Compound Name | 4-N-(phosphanyloxymethyl)quinoline-3,4-diamine |
|---|---|
| PubChem CID | 58294727 |
| Molecular Formula | C10H12N3OP |
| Molecular Weight | 221.20 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 4-N-(phosphanyloxymethyl)quinoline-3,4-diamine |
| SMILES | Nc1cnc2ccccc2c1NCOP |
| InChI | InChI=1S/C10H12N3OP/c11-8-5-12-9-4-2-1-3-7(9)10(8)13-6-14-15/h1-5H,6,11,15H2,(H,12,13) |
| InChIKey | BHWGYFDENCGQOM-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.20 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|