C13H12N4O — CID 114185848
4-N-(1,2-oxazol-5-ylmethyl)quinoline-3,4-diamine (PubChem CID 114185848) has the molecular formula C13H12N4O and a molecular weight of 240.27 g/mol. Its IUPAC name is 4-N-(1,2-oxazol-5-ylmethyl)quinoline-3,4-diamine.
| Compound Name | 4-N-(1,2-oxazol-5-ylmethyl)quinoline-3,4-diamine |
|---|---|
| PubChem CID | 114185848 |
| Molecular Formula | C13H12N4O |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 4-N-(1,2-oxazol-5-ylmethyl)quinoline-3,4-diamine |
| SMILES | Nc1cnc2ccccc2c1NCc1ccno1 |
| InChI | InChI=1S/C13H12N4O/c14-11-8-15-12-4-2-1-3-10(12)13(11)16-7-9-5-6-17-18-9/h1-6,8H,7,14H2,(H,15,16) |
| InChIKey | KMBSOGVNHOFWEO-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |