C13H15N3 — CID 103962731
4-N-(cyclopropylmethyl)quinoline-3,4-diamine (PubChem CID 103962731) has the molecular formula C13H15N3 and a molecular weight of 213.28 g/mol. Its IUPAC name is 4-N-(cyclopropylmethyl)quinoline-3,4-diamine.
| Compound Name | 4-N-(cyclopropylmethyl)quinoline-3,4-diamine |
|---|---|
| PubChem CID | 103962731 |
| Molecular Formula | C13H15N3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 4-N-(cyclopropylmethyl)quinoline-3,4-diamine |
| SMILES | Nc1cnc2ccccc2c1NCC1CC1 |
| InChI | InChI=1S/C13H15N3/c14-11-8-15-12-4-2-1-3-10(12)13(11)16-7-9-5-6-9/h1-4,8-9H,5-7,14H2,(H,15,16) |
| InChIKey | RZQLXFLSRLOLNT-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |