C11H11F2N3 — CID 103963516
4-N-(2,2-difluoroethyl)quinoline-3,4-diamine (PubChem CID 103963516) has the molecular formula C11H11F2N3 and a molecular weight of 223.23 g/mol. Its IUPAC name is 4-N-(2,2-difluoroethyl)quinoline-3,4-diamine.
| Compound Name | 4-N-(2,2-difluoroethyl)quinoline-3,4-diamine |
|---|---|
| PubChem CID | 103963516 |
| Molecular Formula | C11H11F2N3 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | 4-N-(2,2-difluoroethyl)quinoline-3,4-diamine |
| SMILES | Nc1cnc2ccccc2c1NCC(F)F |
| InChI | InChI=1S/C11H11F2N3/c12-10(13)6-16-11-7-3-1-2-4-9(7)15-5-8(11)14/h1-5,10H,6,14H2,(H,15,16) |
| InChIKey | GQDZEKVAIHSLSR-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |