C11H14N4 — CID 103963227
4-N-(2-aminoethyl)quinoline-3,4-diamine (PubChem CID 103963227) has the molecular formula C11H14N4 and a molecular weight of 202.26 g/mol. Its IUPAC name is 4-N-(2-aminoethyl)quinoline-3,4-diamine.
| Compound Name | 4-N-(2-aminoethyl)quinoline-3,4-diamine |
|---|---|
| PubChem CID | 103963227 |
| Molecular Formula | C11H14N4 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 4-N-(2-aminoethyl)quinoline-3,4-diamine |
| SMILES | NCCNc1c(N)cnc2ccccc12 |
| InChI | InChI=1S/C11H14N4/c12-5-6-14-11-8-3-1-2-4-10(8)15-7-9(11)13/h1-4,7H,5-6,12-13H2,(H,14,15) |
| InChIKey | QRVXEFRRCAHUGQ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |