C14H15N5 — CID 103963005
4-N-(2-pyrazol-1-ylethyl)quinoline-3,4-diamine (PubChem CID 103963005) has the molecular formula C14H15N5 and a molecular weight of 253.31 g/mol. Its IUPAC name is 4-N-(2-pyrazol-1-ylethyl)quinoline-3,4-diamine.
| Compound Name | 4-N-(2-pyrazol-1-ylethyl)quinoline-3,4-diamine |
|---|---|
| PubChem CID | 103963005 |
| Molecular Formula | C14H15N5 |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 4-N-(2-pyrazol-1-ylethyl)quinoline-3,4-diamine |
| SMILES | Nc1cnc2ccccc2c1NCCn1cccn1 |
| InChI | InChI=1S/C14H15N5/c15-12-10-17-13-5-2-1-4-11(13)14(12)16-7-9-19-8-3-6-18-19/h1-6,8,10H,7,9,15H2,(H,16,17) |
| InChIKey | WVENGRDFCRLLEG-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |