C15H13N5 — CID 61463091
4-(2-pyrazol-1-ylethylamino)quinoline-3-carbonitrile (PubChem CID 61463091) has the molecular formula C15H13N5 and a molecular weight of 263.30 g/mol. Its IUPAC name is 4-(2-pyrazol-1-ylethylamino)quinoline-3-carbonitrile.
| Compound Name | 4-(2-pyrazol-1-ylethylamino)quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 61463091 |
| Molecular Formula | C15H13N5 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 4-(2-pyrazol-1-ylethylamino)quinoline-3-carbonitrile |
| SMILES | N#Cc1cnc2ccccc2c1NCCn1cccn1 |
| InChI | InChI=1S/C15H13N5/c16-10-12-11-18-14-5-2-1-4-13(14)15(12)17-7-9-20-8-3-6-19-20/h1-6,8,11H,7,9H2,(H,17,18) |
| InChIKey | JIGXAXLRSHQATM-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 66.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |