C16H19N3 — CID 61038828
4-(4-methylpentylamino)quinoline-3-carbonitrile (PubChem CID 61038828) has the molecular formula C16H19N3 and a molecular weight of 253.35 g/mol. Its IUPAC name is 4-(4-methylpentylamino)quinoline-3-carbonitrile.
| Compound Name | 4-(4-methylpentylamino)quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 61038828 |
| Molecular Formula | C16H19N3 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | 4-(4-methylpentylamino)quinoline-3-carbonitrile |
| SMILES | CC(C)CCCNc1c(C#N)cnc2ccccc12 |
| InChI | InChI=1S/C16H19N3/c1-12(2)6-5-9-18-16-13(10-17)11-19-15-8-4-3-7-14(15)16/h3-4,7-8,11-12H,5-6,9H2,1-2H3,(H,18,19) |
| InChIKey | KEVXGSFXXUMZRY-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|