C16H15N5 — CID 80684252
4-[2-(1-methylpyrazol-4-yl)ethylamino]quinoline-3-carbonitrile (PubChem CID 80684252) has the molecular formula C16H15N5 and a molecular weight of 277.33 g/mol. Its IUPAC name is 4-[2-(1-methylpyrazol-4-yl)ethylamino]quinoline-3-carbonitrile.
| Compound Name | 4-[2-(1-methylpyrazol-4-yl)ethylamino]quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 80684252 |
| Molecular Formula | C16H15N5 |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 4-[2-(1-methylpyrazol-4-yl)ethylamino]quinoline-3-carbonitrile |
| SMILES | Cn1cc(CCNc2c(C#N)cnc3ccccc23)cn1 |
| InChI | InChI=1S/C16H15N5/c1-21-11-12(9-20-21)6-7-18-16-13(8-17)10-19-15-5-3-2-4-14(15)16/h2-5,9-11H,6-7H2,1H3,(H,18,19) |
| InChIKey | SINPZKVHDAJWNE-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 66.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |