C21H17N5 — CID 133449169
4-[(1-methyl-3-phenylpyrazol-4-yl)methylamino]quinoline-3-carbonitrile (PubChem CID 133449169) has the molecular formula C21H17N5 and a molecular weight of 339.40 g/mol. Its IUPAC name is 4-[(1-methyl-3-phenylpyrazol-4-yl)methylamino]quinoline-3-carbonitrile.
| Compound Name | 4-[(1-methyl-3-phenylpyrazol-4-yl)methylamino]quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 133449169 |
| Molecular Formula | C21H17N5 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 4-[(1-methyl-3-phenylpyrazol-4-yl)methylamino]quinoline-3-carbonitrile |
| SMILES | Cn1cc(CNc2c(C#N)cnc3ccccc23)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C21H17N5/c1-26-14-17(20(25-26)15-7-3-2-4-8-15)13-24-21-16(11-22)12-23-19-10-6-5-9-18(19)21/h2-10,12,14H,13H2,1H3,(H,23,24) |
| InChIKey | CHTKLBUNVPYSSJ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 66.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |