C19H15F3N4 — CID 133449070
2-[(1-methyl-3-phenylpyrazol-4-yl)methylamino]-5-(trifluoromethyl)benzonitrile (PubChem CID 133449070) has the molecular formula C19H15F3N4 and a molecular weight of 356.35 g/mol. Its IUPAC name is 2-[(1-methyl-3-phenylpyrazol-4-yl)methylamino]-5-(trifluoromethyl)benzonitrile.
| Compound Name | 2-[(1-methyl-3-phenylpyrazol-4-yl)methylamino]-5-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 133449070 |
| Molecular Formula | C19H15F3N4 |
| Molecular Weight | 356.35 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 2-[(1-methyl-3-phenylpyrazol-4-yl)methylamino]-5-(trifluoromethyl)benzonitrile |
| SMILES | Cn1cc(CNc2ccc(C(F)(F)F)cc2C#N)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C19H15F3N4/c1-26-12-15(18(25-26)13-5-3-2-4-6-13)11-24-17-8-7-16(19(20,21)22)9-14(17)10-23/h2-9,12,24H,11H2,1H3 |
| InChIKey | IFBJGJJCPBCFJA-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 53.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.35 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |