C18H15F3N4O4S — CID 133449244
N-[(1-methyl-3-phenylpyrazol-4-yl)methyl]-2-nitro-4-(trifluoromethylsulfonyl)aniline (PubChem CID 133449244) has the molecular formula C18H15F3N4O4S and a molecular weight of 440.40 g/mol. Its IUPAC name is N-[(1-methyl-3-phenylpyrazol-4-yl)methyl]-2-nitro-4-(trifluoromethylsulfonyl)aniline.
| Compound Name | N-[(1-methyl-3-phenylpyrazol-4-yl)methyl]-2-nitro-4-(trifluoromethylsulfonyl)aniline |
|---|---|
| PubChem CID | 133449244 |
| Molecular Formula | C18H15F3N4O4S |
| Molecular Weight | 440.40 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | N-[(1-methyl-3-phenylpyrazol-4-yl)methyl]-2-nitro-4-(trifluoromethylsulfonyl)aniline |
| SMILES | Cn1cc(CNc2ccc(S(=O)(=O)C(F)(F)F)cc2[N+](=O)[O-])c(-c2ccccc2)n1 |
| InChI | InChI=1S/C18H15F3N4O4S/c1-24-11-13(17(23-24)12-5-3-2-4-6-12)10-22-15-8-7-14(9-16(15)25(26)27)30(28,29)18(19,20)21/h2-9,11,22H,10H2,1H3 |
| InChIKey | YNKLXCQRLKQLOT-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 107.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.40 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|