C22H20N6O4S — CID 60605140
N-methyl-3-nitro-4-[(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)methylamino]benzenesulfonamide (PubChem CID 60605140) has the molecular formula C22H20N6O4S and a molecular weight of 464.51 g/mol. Its IUPAC name is N-methyl-3-nitro-4-[(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)methylamino]benzenesulfonamide.
| Compound Name | N-methyl-3-nitro-4-[(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)methylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 60605140 |
| Molecular Formula | C22H20N6O4S |
| Molecular Weight | 464.51 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | N-methyl-3-nitro-4-[(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)methylamino]benzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(NCc2cn(-c3ccccc3)nc2-c2ccncc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H20N6O4S/c1-23-33(31,32)19-7-8-20(21(13-19)28(29)30)25-14-17-15-27(18-5-3-2-4-6-18)26-22(17)16-9-11-24-12-10-16/h2-13,15,23,25H,14H2,1H3 |
| InChIKey | JXENXTOOGQBFJF-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 132.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.51 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|