C22H19N3O2S — CID 22203873
N-[(1,3-diphenylpyrazol-4-yl)methyl]benzenesulfonamide (PubChem CID 22203873) has the molecular formula C22H19N3O2S and a molecular weight of 389.48 g/mol. Its IUPAC name is N-[(1,3-diphenylpyrazol-4-yl)methyl]benzenesulfonamide.
| Compound Name | N-[(1,3-diphenylpyrazol-4-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 22203873 |
| Molecular Formula | C22H19N3O2S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | N-[(1,3-diphenylpyrazol-4-yl)methyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCc1cn(-c2ccccc2)nc1-c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H19N3O2S/c26-28(27,21-14-8-3-9-15-21)23-16-19-17-25(20-12-6-2-7-13-20)24-22(19)18-10-4-1-5-11-18/h1-15,17,23H,16H2 |
| InChIKey | AXKYBXQKQCPPTN-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |